Drug Information
Drug (ID: DG01503) and It's Reported Resistant Information
Name |
TAE226
|
||||
---|---|---|---|---|---|
Synonyms |
761437-28-9; NVP-TAE 226; NVP-TAE226; TAE226; 2-((5-Chloro-2-((2-methoxy-4-morpholinophenyl)amino)pyrimidin-4-yl)amino)-N-methylbenzamide; TAE226 (NVP-TAE226); 2-({5-Chloro-2-[(2-Methoxy-4-Morpholin-4-Ylphenyl)amino]pyrimidin-4-Yl}amino)-N-Methylbenzamide; CHEMBL458997; TAE-226; CTx0152960; 1042432-58-5; 2-((5-CHLORO-2-((2-METHOXY-4-MORPHOLINOPHENYL)-AMINO)PYRIMIDIN-4-YL)AMINO)-N-METHYLBENZAMIDE; CTx-0152960;CTx 0152960; C23H25ClN6O3; 2-[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methylbenzamide; 2jkk; 2-[[5-chloro-2-[(2-methoxy-4-morpholin-4-ylphenyl)amino]pyrimidin-4-yl]amino]-N-methylbenzamide; BI9; Kinome_1212; NVP TAE226; NVPTAE 226; MLS006011059; SCHEMBL375524; GTPL9382; CHEBI:91452; DTXSID90433025; EX-A716; TAE 226; HMS3656L12; HMS3672E03; HMS3747C09; AOB87333; BCP06482; 1836AC; BDBM50334594; MFCD12031516; NSC787252; s2820; ZINC20148986; AKOS016004135; CCG-269438; CS-0594; DB07460; NSC-787252; SB19397; 2-({5-Chloro-2-[2-methoxy-4-(morpholin-4-yl)anilino]pyrimidin-4-yl}amino)-N-methylbenzamide; NCGC00346931-01; NCGC00346931-05; 2-[5-chloro-2-(2-methoxy-4-morpholin-4-yl-phenylamino)-pyrimidin-4-ylamino]-N-methyl-benzamide; AC-27408; AS-56281; HY-13203; SMR004702851; FT-0700360; SW219314-1; NVP-TAE 226,CAS:761437-28-9; A865545; J-690348; Q27096680; 2-({5-Chloro-2-[2-methoxy-4-(4-morpholinyl)anilino]-4-pyrimidinyl}amino)-N-methylbenzamide; 2-(5-chloro-2-(2-methoxy-4-morpholinophenylamino)pyrimidin-4-ylamino)-N-methylbenzamide; 2-[5-chloro-2-[2-methoxy-4-(4-morpholinyl)phenylamino]pyrimidin-4-ylamino]-N-methylbenzamide
Click to Show/Hide
|
||||
Structure |
![]() |
||||
Target | . | NOUNIPROTAC | [1] | ||
Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
Formula |
7
|
||||
IsoSMILES |
CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=C(C=C(C=C3)N4CCOCC4)OC
|
||||
InChI |
InChI=1S/C23H25ClN6O3/c1-25-22(31)16-5-3-4-6-18(16)27-21-17(24)14-26-23(29-21)28-19-8-7-15(13-20(19)32-2)30-9-11-33-12-10-30/h3-8,13-14H,9-12H2,1-2H3,(H,25,31)(H2,26,27,28,29)
|
||||
InChIKey |
UYJNQQDJUOUFQJ-UHFFFAOYSA-N
|
||||
PubChem CID |
Type(s) of Resistant Mechanism of This Drug
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: Epidermal growth factor receptor (EGFR) | [1] | |||
Molecule Alteration | Missense mutation | p.L858R (c.2573T>G) |
||
Sensitive Disease | Solid tumour/cancer [ICD-11: 2A00-2F9Z] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | NCI-H2228 cells | Lung | Homo sapiens (Human) | CVCL_1543 |
HCC827 cells | Lung | Homo sapiens (Human) | CVCL_2063 | |
NCI-H838 cells | Lung | Homo sapiens (Human) | CVCL_1594 | |
NCI-H1975 cells | Lung | Homo sapiens (Human) | CVCL_1511 | |
HCC4006 cells | Lung | Homo sapiens (Human) | CVCL_1269 | |
NCI-H1395 cells | Lung | Homo sapiens (Human) | CVCL_1467 | |
SkBR3 cells | Breast | Homo sapiens (Human) | CVCL_0033 | |
HEK293T cells | Kidney | Homo sapiens (Human) | CVCL_0063 | |
NCI-H820 cells | Lymph node | Homo sapiens (Human) | CVCL_1592 | |
NCI-H3255 cells | Lung | Homo sapiens (Human) | CVCL_6831 | |
NCI-H1993 cells | Lymph node | Homo sapiens (Human) | CVCL_1512 | |
NCI-H1819 cells | Lymph node | Homo sapiens (Human) | CVCL_1497 | |
NCI-H1666 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1485 | |
NCI-H1648 cells | Lymph node | Homo sapiens (Human) | CVCL_1482 | |
NCI-H1299 cells | Lymph node | Homo sapiens (Human) | CVCL_0060 | |
MKN45 cells | Liver | Homo sapiens (Human) | CVCL_0434 | |
In Vivo Model | BALB/c-nu/nu female nude mouse PC9 xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Experiment for Drug Resistance |
CellTiter-96 AQueous One assay |
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: Serine/threonine-protein kinase B-raf (BRAF) | [1] | |||
Molecule Alteration | Missense mutation | p.G466V (c.1397G>T) |
||
Sensitive Disease | Lung adenocarcinoma [ICD-11: 2C25.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | NCI-H2228 cells | Lung | Homo sapiens (Human) | CVCL_1543 |
HCC827 cells | Lung | Homo sapiens (Human) | CVCL_2063 | |
NCI-H838 cells | Lung | Homo sapiens (Human) | CVCL_1594 | |
NCI-H1975 cells | Lung | Homo sapiens (Human) | CVCL_1511 | |
HCC4006 cells | Lung | Homo sapiens (Human) | CVCL_1269 | |
NCI-H1395 cells | Lung | Homo sapiens (Human) | CVCL_1467 | |
SkBR3 cells | Breast | Homo sapiens (Human) | CVCL_0033 | |
HEK293T cells | Kidney | Homo sapiens (Human) | CVCL_0063 | |
NCI-H820 cells | Lymph node | Homo sapiens (Human) | CVCL_1592 | |
NCI-H3255 cells | Lung | Homo sapiens (Human) | CVCL_6831 | |
NCI-H1993 cells | Lymph node | Homo sapiens (Human) | CVCL_1512 | |
NCI-H1819 cells | Lymph node | Homo sapiens (Human) | CVCL_1497 | |
NCI-H1666 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1485 | |
NCI-H1648 cells | Lymph node | Homo sapiens (Human) | CVCL_1482 | |
NCI-H1299 cells | Lymph node | Homo sapiens (Human) | CVCL_0060 | |
MKN45 cells | Liver | Homo sapiens (Human) | CVCL_0434 | |
In Vivo Model | BALB/c-nu/nu female nude mouse PC9 xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Experiment for Drug Resistance |
CellTiter-96 AQueous One assay | |||
Key Molecule: Serine/threonine-protein kinase B-raf (BRAF) | [1] | |||
Molecule Alteration | Missense mutation | p.G469A (c.1406G>C) |
||
Sensitive Disease | Lung adenocarcinoma [ICD-11: 2C25.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | NCI-H2228 cells | Lung | Homo sapiens (Human) | CVCL_1543 |
HCC827 cells | Lung | Homo sapiens (Human) | CVCL_2063 | |
NCI-H838 cells | Lung | Homo sapiens (Human) | CVCL_1594 | |
NCI-H1975 cells | Lung | Homo sapiens (Human) | CVCL_1511 | |
HCC4006 cells | Lung | Homo sapiens (Human) | CVCL_1269 | |
NCI-H1395 cells | Lung | Homo sapiens (Human) | CVCL_1467 | |
SkBR3 cells | Breast | Homo sapiens (Human) | CVCL_0033 | |
HEK293T cells | Kidney | Homo sapiens (Human) | CVCL_0063 | |
NCI-H820 cells | Lymph node | Homo sapiens (Human) | CVCL_1592 | |
NCI-H3255 cells | Lung | Homo sapiens (Human) | CVCL_6831 | |
NCI-H1993 cells | Lymph node | Homo sapiens (Human) | CVCL_1512 | |
NCI-H1819 cells | Lymph node | Homo sapiens (Human) | CVCL_1497 | |
NCI-H1666 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1485 | |
NCI-H1648 cells | Lymph node | Homo sapiens (Human) | CVCL_1482 | |
NCI-H1299 cells | Lymph node | Homo sapiens (Human) | CVCL_0060 | |
MKN45 cells | Liver | Homo sapiens (Human) | CVCL_0434 | |
In Vivo Model | BALB/c-nu/nu female nude mouse PC9 xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Experiment for Drug Resistance |
CellTiter-96 AQueous One assay | |||
Key Molecule: Epidermal growth factor receptor (EGFR) | [1] | |||
Molecule Alteration | Missense mutation | p.L858R (c.2573T>G) |
||
Sensitive Disease | Lung adenocarcinoma [ICD-11: 2C25.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | NCI-H2228 cells | Lung | Homo sapiens (Human) | CVCL_1543 |
HCC827 cells | Lung | Homo sapiens (Human) | CVCL_2063 | |
NCI-H838 cells | Lung | Homo sapiens (Human) | CVCL_1594 | |
NCI-H1975 cells | Lung | Homo sapiens (Human) | CVCL_1511 | |
HCC4006 cells | Lung | Homo sapiens (Human) | CVCL_1269 | |
NCI-H1395 cells | Lung | Homo sapiens (Human) | CVCL_1467 | |
SkBR3 cells | Breast | Homo sapiens (Human) | CVCL_0033 | |
HEK293T cells | Kidney | Homo sapiens (Human) | CVCL_0063 | |
NCI-H820 cells | Lymph node | Homo sapiens (Human) | CVCL_1592 | |
NCI-H3255 cells | Lung | Homo sapiens (Human) | CVCL_6831 | |
NCI-H1993 cells | Lymph node | Homo sapiens (Human) | CVCL_1512 | |
NCI-H1819 cells | Lymph node | Homo sapiens (Human) | CVCL_1497 | |
NCI-H1666 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1485 | |
NCI-H1648 cells | Lymph node | Homo sapiens (Human) | CVCL_1482 | |
NCI-H1299 cells | Lymph node | Homo sapiens (Human) | CVCL_0060 | |
MKN45 cells | Liver | Homo sapiens (Human) | CVCL_0434 | |
In Vivo Model | BALB/c-nu/nu female nude mouse PC9 xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Experiment for Drug Resistance |
CellTiter-96 AQueous One assay |
References
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Zhang.