Drug Information
Drug (ID: DG01620) and It's Reported Resistant Information
Name |
ARQ 751
|
||||
---|---|---|---|---|---|
Synonyms |
Vevorisertib; UNII-V6SX910Y31; V6SX910Y31; 1416775-46-6; Vevorisertib [INN]; CHEMBL4802156; SCHEMBL14322498; ARQ-751; EX-A5803; HY-137458; CS-0138665; Acetamide, N-(1-(3-(3-(4-(1-aminocyclobutyl)phenyl)-2-(2-amino-3-pyridinyl)-3H-imidazo(4,5-b)pyridin-5-yl)phenyl)-4-piperidinyl)-N-methyl-; N-[1-[3-[3-[4-(1-aminocyclobutyl)phenyl]-2-(2-aminopyridin-3-yl)imidazo[4,5-b]pyridin-5-yl]phenyl]piperidin-4-yl]-N-methylacetamide
Click to Show/Hide
|
||||
Indication |
In total 1 Indication(s)
|
||||
Structure |
![]() |
||||
Target | RAC-alpha serine/threonine-protein kinase (AKT1) | AKT1_HUMAN | [1] | ||
Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
Formula |
6
|
||||
IsoSMILES |
CC(=O)N(C)C1CCN(CC1)C2=CC=CC(=C2)C3=NC4=C(C=C3)N=C(N4C5=CC=C(C=C5)C6(CCC6)N)C7=C(N=CC=C7)N
|
||||
InChI |
InChI=1S/C35H38N8O/c1-23(44)41(2)26-15-20-42(21-16-26)28-7-3-6-24(22-28)30-13-14-31-34(39-30)43(33(40-31)29-8-4-19-38-32(29)36)27-11-9-25(10-12-27)35(37)17-5-18-35/h3-4,6-14,19,22,26H,5,15-18,20-21,37H2,1-2H3,(H2,36,38)
|
||||
InChIKey |
NZDSLYATTDIDPH-UHFFFAOYSA-N
|
||||
PubChem CID |
Type(s) of Resistant Mechanism of This Drug
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: PI3-kinase alpha (PIK3CA) | [1] | |||
Molecule Alteration | Missense mutation | p.K111N (c.333G>C) |
||
Sensitive Disease | Breast adenocarcinoma [ICD-11: 2C60.1] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | DU-145 cells | Prostate | Homo sapiens (Human) | CVCL_0105 |
LNCaP cells | Prostate | Homo sapiens (Human) | CVCL_0395 | |
MDA-MB-231 cells | Breast | Homo sapiens (Human) | CVCL_0062 | |
Hela cells | Cervix uteri | Homo sapiens (Human) | CVCL_0030 | |
T47D cells | Breast | Homo sapiens (Human) | CVCL_0553 | |
NCI-H460 cells | Lung | Homo sapiens (Human) | CVCL_0459 | |
MDA-MB-453 cells | Breast | Homo sapiens (Human) | CVCL_0418 | |
MDA-MB-468 cells | Breast | Homo sapiens (Human) | CVCL_0419 | |
HCC70 cells | Breast | Homo sapiens (Human) | CVCL_1270 | |
A2058 cells | Skin | Homo sapiens (Human) | CVCL_1059 | |
Caco-2 cells | Colon | Homo sapiens (Human) | CVCL_0025 | |
MCF-7 cells | Breast | Homo sapiens (Human) | CVCL_0031 | |
ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
NCI-60 cells | N.A. | Homo sapiens (Human) | N.A. | |
KU-19 cells | Blood | Bos taurus (Bovine) | CVCL_VN09 | |
EVSA-T cells | Ascites | Homo sapiens (Human) | CVCL_1207 | |
CAL-120 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1104 | |
BT-549 cells | Breast | Homo sapiens (Human) | CVCL_1092 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
BT-20 cells | Mammary gland | Homo sapiens (Human) | CVCL_0178 | |
B16F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Female NMRI (nu/nu) mouse xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Mechanism Description | The missense mutation p.K111N (c.333G>C) in gene PIK3CA cause the sensitivity of ARQ 751 by aberration of the drug's therapeutic target | |||
Key Molecule: PI3-kinase alpha (PIK3CA) | [1] | |||
Molecule Alteration | Missense mutation | p.E545K (c.1633G>A) |
||
Sensitive Disease | Breast adenocarcinoma [ICD-11: 2C60.1] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | DU-145 cells | Prostate | Homo sapiens (Human) | CVCL_0105 |
LNCaP cells | Prostate | Homo sapiens (Human) | CVCL_0395 | |
MDA-MB-231 cells | Breast | Homo sapiens (Human) | CVCL_0062 | |
Hela cells | Cervix uteri | Homo sapiens (Human) | CVCL_0030 | |
T47D cells | Breast | Homo sapiens (Human) | CVCL_0553 | |
NCI-H460 cells | Lung | Homo sapiens (Human) | CVCL_0459 | |
MDA-MB-453 cells | Breast | Homo sapiens (Human) | CVCL_0418 | |
MDA-MB-468 cells | Breast | Homo sapiens (Human) | CVCL_0419 | |
HCC70 cells | Breast | Homo sapiens (Human) | CVCL_1270 | |
A2058 cells | Skin | Homo sapiens (Human) | CVCL_1059 | |
Caco-2 cells | Colon | Homo sapiens (Human) | CVCL_0025 | |
MCF-7 cells | Breast | Homo sapiens (Human) | CVCL_0031 | |
ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
NCI-60 cells | N.A. | Homo sapiens (Human) | N.A. | |
KU-19 cells | Blood | Bos taurus (Bovine) | CVCL_VN09 | |
EVSA-T cells | Ascites | Homo sapiens (Human) | CVCL_1207 | |
CAL-120 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1104 | |
BT-549 cells | Breast | Homo sapiens (Human) | CVCL_1092 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
BT-20 cells | Mammary gland | Homo sapiens (Human) | CVCL_0178 | |
B16F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Female NMRI (nu/nu) mouse xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Mechanism Description | The missense mutation p.E545K (c.1633G>A) in gene PIK3CA cause the sensitivity of ARQ 751 by aberration of the drug's therapeutic target | |||
Key Molecule: PI3-kinase alpha (PIK3CA) | [1] | |||
Molecule Alteration | Missense mutation | p.H1047R (c.3140A>G) |
||
Sensitive Disease | Breast adenocarcinoma [ICD-11: 2C60.1] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | DU-145 cells | Prostate | Homo sapiens (Human) | CVCL_0105 |
LNCaP cells | Prostate | Homo sapiens (Human) | CVCL_0395 | |
MDA-MB-231 cells | Breast | Homo sapiens (Human) | CVCL_0062 | |
Hela cells | Cervix uteri | Homo sapiens (Human) | CVCL_0030 | |
T47D cells | Breast | Homo sapiens (Human) | CVCL_0553 | |
NCI-H460 cells | Lung | Homo sapiens (Human) | CVCL_0459 | |
MDA-MB-453 cells | Breast | Homo sapiens (Human) | CVCL_0418 | |
MDA-MB-468 cells | Breast | Homo sapiens (Human) | CVCL_0419 | |
HCC70 cells | Breast | Homo sapiens (Human) | CVCL_1270 | |
A2058 cells | Skin | Homo sapiens (Human) | CVCL_1059 | |
Caco-2 cells | Colon | Homo sapiens (Human) | CVCL_0025 | |
MCF-7 cells | Breast | Homo sapiens (Human) | CVCL_0031 | |
ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
NCI-60 cells | N.A. | Homo sapiens (Human) | N.A. | |
KU-19 cells | Blood | Bos taurus (Bovine) | CVCL_VN09 | |
EVSA-T cells | Ascites | Homo sapiens (Human) | CVCL_1207 | |
CAL-120 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1104 | |
BT-549 cells | Breast | Homo sapiens (Human) | CVCL_1092 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
BT-20 cells | Mammary gland | Homo sapiens (Human) | CVCL_0178 | |
B16F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Female NMRI (nu/nu) mouse xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Mechanism Description | The missense mutation p.H1047R (c.3140A>G) in gene PIK3CA cause the sensitivity of ARQ 751 by aberration of the drug's therapeutic target |
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: RAC-alpha serine/threonine-protein kinase (AKT1) | [1] | |||
Molecule Alteration | Missense mutation | p.E17K (c.49G>A) |
||
Sensitive Disease | Endometrial adenocarcinoma [ICD-11: 2C76.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | DU-145 cells | Prostate | Homo sapiens (Human) | CVCL_0105 |
LNCaP cells | Prostate | Homo sapiens (Human) | CVCL_0395 | |
MDA-MB-231 cells | Breast | Homo sapiens (Human) | CVCL_0062 | |
Hela cells | Cervix uteri | Homo sapiens (Human) | CVCL_0030 | |
T47D cells | Breast | Homo sapiens (Human) | CVCL_0553 | |
NCI-H460 cells | Lung | Homo sapiens (Human) | CVCL_0459 | |
MDA-MB-453 cells | Breast | Homo sapiens (Human) | CVCL_0418 | |
MDA-MB-468 cells | Breast | Homo sapiens (Human) | CVCL_0419 | |
HCC70 cells | Breast | Homo sapiens (Human) | CVCL_1270 | |
A2058 cells | Skin | Homo sapiens (Human) | CVCL_1059 | |
Caco-2 cells | Colon | Homo sapiens (Human) | CVCL_0025 | |
MCF-7 cells | Breast | Homo sapiens (Human) | CVCL_0031 | |
ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
NCI-60 cells | N.A. | Homo sapiens (Human) | N.A. | |
KU-19 cells | Blood | Bos taurus (Bovine) | CVCL_VN09 | |
EVSA-T cells | Ascites | Homo sapiens (Human) | CVCL_1207 | |
CAL-120 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1104 | |
BT-549 cells | Breast | Homo sapiens (Human) | CVCL_1092 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
BT-20 cells | Mammary gland | Homo sapiens (Human) | CVCL_0178 | |
B16F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Female NMRI (nu/nu) mouse xenograft model | Mus musculus | ||
Experiment for Molecule Alteration |
Western blotting analysis | |||
Mechanism Description | The missense mutation p.E17K (c.49G>A) in gene AKT1 cause the sensitivity of ARQ 751 by aberration of the drug's therapeutic target |
References
visits since 2022
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Zhang.