Drug Information
Drug (ID: DG01535) and It's Reported Resistant Information
Name |
RO-5126766 free base
|
||||
---|---|---|---|---|---|
Synonyms |
946128-88-7; RO5126766; RO-5126766; CH5126766; Ro 5126766; RO-5126766 free base; RO5126766(CH5126766); CHEBI:78825; CH-5126766; Ro 5126766 - Bio-X; RG-7304; CKI-27; 3-[[2-[(methylaminosulfonyl)amino]-3-fluoropyridin-4-yl]methyl]-4-methyl-7-[(pyrimidin-2-yl)oxy]-2H-1-benzopyran-2-one; CHEMBL3264002; UNII-D0D4252V97; RO5126766 (CH5126766); D0D4252V97; VS-6766; N-(3-Fluoro-4-{[4-Methyl-2-Oxo-7-(Pyrimidin-2-Yloxy)-2h-Chromen-3-Yl]methyl}pyridin-2-Yl)-N'-Methylsulfuric Diamide; avutometinib; 3wig; CHU; SCHEMBL960093; GTPL11867; BCP21067; EX-A2151; BDBM50010462; NSC758248; NSC800871; s7170; ZINC68247388; AKOS030527032; CCG-269457; compound 1 [PMID: 24900832]; CS-5254; DB15254; NSC-758248; NSC-800871; SB16628; DA-40233; HY-18652; B5820; CH 5126766; FT-0737411; R-7304; A916428; RO5126766; CH5126766; Q27147976; RO 5126766; RO5126766; CH5126766; CH5126766; CH 5126766; 3-[(2-((N-methylsulfamoyl)amino)-3-fluoropyridin-4-yl)methyl]-4-methyl-7-(pyrimidin-2-yloxy)-chromen-2-one; 3-[[3-fluoro-2-(methylsulfamoylamino)pyridin-4-yl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one; Sulfamide, N-(3-fluoro-4-((4-methyl-2-oxo-7-(2-pyrimidinyloxy)-2H-1-benzopyran-3-yl)methyl)-2-pyridinyl)-N'-methyl-
Click to Show/Hide
|
||||
Indication |
In total 1 Indication(s)
|
||||
Structure |
![]() |
||||
Target | . | NOUNIPROTAC | [2] | ||
Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
Formula |
7
|
||||
IsoSMILES |
CC1=C(C(=O)OC2=C1C=CC(=C2)OC3=NC=CC=N3)CC4=C(C(=NC=C4)NS(=O)(=O)NC)F
|
||||
InChI |
InChI=1S/C21H18FN5O5S/c1-12-15-5-4-14(31-21-25-7-3-8-26-21)11-17(15)32-20(28)16(12)10-13-6-9-24-19(18(13)22)27-33(29,30)23-2/h3-9,11,23H,10H2,1-2H3,(H,24,27)
|
||||
InChIKey |
LMMJFBMMJUMSJS-UHFFFAOYSA-N
|
||||
PubChem CID | |||||
ChEBI ID | |||||
TTD Drug ID | |||||
DrugBank ID |
Type(s) of Resistant Mechanism of This Drug
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: Serine/threonine-protein kinase B-raf (BRAF) | [1] | |||
Molecule Alteration | Missense mutation | p.V600E (c.1799T>A) |
||
Sensitive Disease | Melanoma [ICD-11: 2C30.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | HCT116 cells | Colon | Homo sapiens (Human) | CVCL_0291 |
NCI-N87 cells | Gastric | Homo sapiens (Human) | CVCL_1603 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
NCI-H716 cells | Colon | Homo sapiens (Human) | CVCL_1581 | |
SNU-16 cells | Gastric | Homo sapiens (Human) | CVCL_0076 | |
NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
RT-4 cells | Urinary bladder | Homo sapiens (Human) | CVCL_0036 | |
ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
NCI-N87 cells | Gastric | Homo sapiens (Human) | CVCL_1603 | |
NCI-H716 cells | Colon | Homo sapiens (Human) | CVCL_1581 | |
KATO-3 cells | Gastric | Homo sapiens (Human) | CVCL_0371 | |
SNU-16 cells | Gastric | Homo sapiens (Human) | CVCL_0076 | |
NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
RT-4 cells | Urinary bladder | Homo sapiens (Human) | CVCL_0036 | |
UM-UC-14 cells | Kidney | Homo sapiens (Human) | CVCL_2747 | |
SUM-52PE cells | Pleural effusion | Homo sapiens (Human) | CVCL_3425 | |
NCI-H1581 cells | Lung | Homo sapiens (Human) | CVCL_1479 | |
MFE296 cells | Endometrium | Homo sapiens (Human) | CVCL_1406 | |
MFE280 cells | Endometrium | Homo sapiens (Human) | CVCL_1405 | |
KMS-11 cells | Pleural effusion | Homo sapiens (Human) | CVCL_2989 | |
HSC-39 cells | Ascites | Homo sapiens (Human) | CVCL_A385 | |
DMS-114 cells | Lung | Homo sapiens (Human) | CVCL_1174 | |
AN3 CA cells | Endometrium | Homo sapiens (Human) | CVCL_0028 | |
UM-UC-14 cells | Kidney | Homo sapiens (Human) | CVCL_2747 | |
KATO-III cells | Pleural effusion | Homo sapiens (Human) | CVCL_0371 | |
AN3 CA cells | Endometrium | Homo sapiens (Human) | CVCL_0028 | |
Experiment for Molecule Alteration |
Microarray assay; Western blotting analysis | |||
Experiment for Drug Resistance |
CCK-8 assay |
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: Fibroblast growth factor receptor 2 (FGFR2) | [1] | |||
Molecule Alteration | Missense mutation | p.S252W (c.755C>G) |
||
Sensitive Disease | Endometrial adenocarcinoma [ICD-11: 2C76.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | HCT116 cells | Colon | Homo sapiens (Human) | CVCL_0291 |
NCI-N87 cells | Gastric | Homo sapiens (Human) | CVCL_1603 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
NCI-H716 cells | Colon | Homo sapiens (Human) | CVCL_1581 | |
SNU-16 cells | Gastric | Homo sapiens (Human) | CVCL_0076 | |
NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
RT-4 cells | Urinary bladder | Homo sapiens (Human) | CVCL_0036 | |
ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
NCI-N87 cells | Gastric | Homo sapiens (Human) | CVCL_1603 | |
NCI-H716 cells | Colon | Homo sapiens (Human) | CVCL_1581 | |
KATO-3 cells | Gastric | Homo sapiens (Human) | CVCL_0371 | |
SNU-16 cells | Gastric | Homo sapiens (Human) | CVCL_0076 | |
NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
RT-4 cells | Urinary bladder | Homo sapiens (Human) | CVCL_0036 | |
UM-UC-14 cells | Kidney | Homo sapiens (Human) | CVCL_2747 | |
SUM-52PE cells | Pleural effusion | Homo sapiens (Human) | CVCL_3425 | |
NCI-H1581 cells | Lung | Homo sapiens (Human) | CVCL_1479 | |
MFE296 cells | Endometrium | Homo sapiens (Human) | CVCL_1406 | |
MFE280 cells | Endometrium | Homo sapiens (Human) | CVCL_1405 | |
KMS-11 cells | Pleural effusion | Homo sapiens (Human) | CVCL_2989 | |
HSC-39 cells | Ascites | Homo sapiens (Human) | CVCL_A385 | |
DMS-114 cells | Lung | Homo sapiens (Human) | CVCL_1174 | |
AN3 CA cells | Endometrium | Homo sapiens (Human) | CVCL_0028 | |
UM-UC-14 cells | Kidney | Homo sapiens (Human) | CVCL_2747 | |
KATO-III cells | Pleural effusion | Homo sapiens (Human) | CVCL_0371 | |
AN3 CA cells | Endometrium | Homo sapiens (Human) | CVCL_0028 | |
Experiment for Molecule Alteration |
Microarray assay; Western blotting analysis | |||
Experiment for Drug Resistance |
CCK-8 assay |
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
||||
Key Molecule: Serine/threonine-protein kinase B-raf (BRAF) | [2] | |||
Molecule Alteration | Missense mutation | p.V600E (c.1799T>A) |
||
Sensitive Disease | Thyroid gland cancer [ICD-11: 2D10.0] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
Cell Pathway Regulation | ERK signaling pathway | Inhibition | hsa04210 |
References
visits since 2022
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Zhang.