Drug Information
Drug (ID: DG01519) and It's Reported Resistant Information
| Name |
RO4987655
|
||||
|---|---|---|---|---|---|
| Synonyms |
RO4987655; 874101-00-5; RO-4987655; CH4987655; CH-4987655; UNII-I3733P75ML; 3,4-Difluoro-2-[(2-Fluoro-4-Iodophenyl)amino]-N-(2-Hydroxyethoxy)-5-[(3-Oxo-1,2-Oxazinan-2-Yl)methyl]benzamide; 3,4-difluoro-2-(2-fluoro-4-iodophenylamino)-N-(2-hydroxyethoxy)-5-((3-oxomorpholino)methyl)benzamide; CHEMBL1614766; I3733P75ML; RO 4987655; 3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)-N-(2-hydroxyethoxy)-5-((3-oxo-1,2-oxazinan-2-yl)methyl)benzamide; C20H19F3IN3O5; 3,4-Difluoro-2-(2-fluoro-4-iodo-anilino)-N-(2-hydroxyethoxy)-5-[(3-oxooxazinan-2-yl)methyl]benzamide; 3orn; GTPL9910; SCHEMBL1562083; SYN1188; BCP12182; EX-A2312; 4014AH; BDBM50338038; NSC762521; NSC800870; RG7167; ZINC43103796; AKOS005266648; DB12933; NSC-762521; NSC-800870; SB16732; r-7167; compound 24 [PMID: 21316218]; NCGC00378595-03; AS-16322; HY-14719; DS-016573; B3261; US8575391, 334; RO4987655; CH-4987655; Q27280303; 3,4-difluoro-2-(2-fluoro-4-iodo-phenylamino)-N-(2-hydroxy-ethoxy)-5-(3-oxo-[1,2]oxazinan-2-ylmethyl)-benzamide; 3,4-Difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-oxo-2-oxazinanyl)methyl]benzamide; 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-oxooxazinan-2-yl)methyl]benzamide; 3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]-N-(2-hydroxyethoxy)-5-[(3-oxooxazinan-2-yl)methyl]benzamide; 3OR; Benzamide, 3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]-N-(2-hydroxyethoxy)-5-[(tetrahydro-3-oxo-2H-1,2-oxazin-2-yl)methyl]-
Click to Show/Hide
|
||||
| Structure |
|
||||
| Target | . | NOUNIPROTAC | [1] | ||
| Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
| Formula |
8
|
||||
| IsoSMILES |
C1CC(=O)N(OC1)CC2=CC(=C(C(=C2F)F)NC3=C(C=C(C=C3)I)F)C(=O)NOCCO
|
||||
| InChI |
InChI=1S/C20H19F3IN3O5/c21-14-9-12(24)3-4-15(14)25-19-13(20(30)26-31-7-5-28)8-11(17(22)18(19)23)10-27-16(29)2-1-6-32-27/h3-4,8-9,25,28H,1-2,5-7,10H2,(H,26,30)
|
||||
| InChIKey |
FIMYFEGKMOCQKT-UHFFFAOYSA-N
|
||||
| PubChem CID | |||||
| DrugBank ID | |||||
Type(s) of Resistant Mechanism of This Drug
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
| Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
|
||||
| Key Molecule: Serine/threonine-protein kinase B-raf (BRAF) | [1] | |||
| Molecule Alteration | Missense mutation | p.V600X (c.1798_1799) |
||
| Sensitive Disease | Melanoma [ICD-11: 2C30.0] | |||
| Experimental Note | Identified from the Human Clinical Data | |||
| In Vitro Model | Skin sample | N.A. | ||
| Experiment for Molecule Alteration |
IHC assay; Tumor-DNA mutation analysis | |||
| Experiment for Drug Resistance |
Pharmacokinetics analysis; Tumor biopsies analysis | |||
| Key Molecule: Serine/threonine-protein kinase B-raf (BRAF) | [2] | |||
| Molecule Alteration | Missense mutation | p.V600E (c.1799T>A) |
||
| Sensitive Disease | Melanoma [ICD-11: 2C30.0] | |||
| Experimental Note | Revealed Based on the Cell Line Data | |||
| In Vitro Model | HCT116 cells | Colon | Homo sapiens (Human) | CVCL_0291 |
| NCI-N87 cells | Gastric | Homo sapiens (Human) | CVCL_1603 | |
| MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
| NCI-H716 cells | Colon | Homo sapiens (Human) | CVCL_1581 | |
| SNU-16 cells | Gastric | Homo sapiens (Human) | CVCL_0076 | |
| NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
| RT-4 cells | Urinary bladder | Homo sapiens (Human) | CVCL_0036 | |
| ZR75-1 cells | Breast | Homo sapiens (Human) | CVCL_0588 | |
| NCI-N87 cells | Gastric | Homo sapiens (Human) | CVCL_1603 | |
| NCI-H716 cells | Colon | Homo sapiens (Human) | CVCL_1581 | |
| KATO-3 cells | Gastric | Homo sapiens (Human) | CVCL_0371 | |
| SNU-16 cells | Gastric | Homo sapiens (Human) | CVCL_0076 | |
| NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
| RT-4 cells | Urinary bladder | Homo sapiens (Human) | CVCL_0036 | |
| UM-UC-14 cells | Kidney | Homo sapiens (Human) | CVCL_2747 | |
| SUM-52PE cells | Pleural effusion | Homo sapiens (Human) | CVCL_3425 | |
| NCI-H1581 cells | Lung | Homo sapiens (Human) | CVCL_1479 | |
| MFE296 cells | Endometrium | Homo sapiens (Human) | CVCL_1406 | |
| MFE280 cells | Endometrium | Homo sapiens (Human) | CVCL_1405 | |
| KMS-11 cells | Pleural effusion | Homo sapiens (Human) | CVCL_2989 | |
| HSC-39 cells | Ascites | Homo sapiens (Human) | CVCL_A385 | |
| DMS-114 cells | Lung | Homo sapiens (Human) | CVCL_1174 | |
| AN3 CA cells | Endometrium | Homo sapiens (Human) | CVCL_0028 | |
| UM-UC-14 cells | Kidney | Homo sapiens (Human) | CVCL_2747 | |
| KATO-III cells | Pleural effusion | Homo sapiens (Human) | CVCL_0371 | |
| AN3 CA cells | Endometrium | Homo sapiens (Human) | CVCL_0028 | |
| Experiment for Molecule Alteration |
Microarray assay; Western blotting analysis | |||
| Experiment for Drug Resistance |
CCK-8 assay | |||
References
visits since 2022
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Zhang.
