Drug Information
Drug (ID: DG01481) and It's Reported Resistant Information
| Name |
TASIN-1
|
||||
|---|---|---|---|---|---|
| Synonyms |
TASIN-1; 792927-06-1; 1'-((4-methoxyphenyl)sulfonyl)-4-methyl-1,4'-bipiperidine; 1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-4-methylpiperidine; 1'-[(4-methoxyphenyl)sulfonyl]-4-methyl-1,4'-bipiperidine; CHEMBL4514756; SCHEMBL17007497; ZINC4744379; NSC766210; STK193520; AKOS003649063; HY-116572A; MCULE-6685404683; NSC-766210; AT-057/43468793; 1-[(4-methoxyphenyl)sulfonyl]-4'-methyl-4,1'-bipiperidine
Click to Show/Hide
|
||||
| Structure |
|
||||
| Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
| Formula |
4
|
||||
| IsoSMILES |
CC1CCN(CC1)C2CCN(CC2)S(=O)(=O)C3=CC=C(C=C3)OC
|
||||
| InChI |
InChI=1S/C18H28N2O3S/c1-15-7-11-19(12-8-15)16-9-13-20(14-10-16)24(21,22)18-5-3-17(23-2)4-6-18/h3-6,15-16H,7-14H2,1-2H3
|
||||
| InChIKey |
XCBHYDPDIJQQGM-UHFFFAOYSA-N
|
||||
| PubChem CID | |||||
Type(s) of Resistant Mechanism of This Drug
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
| Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
|
||||
| Key Molecule: Adenomatous polyposis coli protein (APC) | [1] | |||
| Sensitive Disease | Colorectal cancer [ICD-11: 2B91.1] | |||
| Molecule Alteration | Missense mutation | p.G1416* (c.4246_4248delGGCinsTGA) |
||
| Experimental Note | Revealed Based on the Cell Line Data | |||
| In Vitro Model | HT29 Cells | Colon | Homo sapiens (Human) | CVCL_A8EZ |
| SW480 cells | Colon | Homo sapiens (Human) | CVCL_0546 | |
| DLD1 cells | Colon | Homo sapiens (Human) | CVCL_0248 | |
| SW620 cells | Colon | Homo sapiens (Human) | CVCL_0547 | |
| HCT116 cells | Colon | Homo sapiens (Human) | CVCL_0291 | |
| RkO cells | Colon | Homo sapiens (Human) | CVCL_0504 | |
| NCI-H508 cells | Colon | Homo sapiens (Human) | CVCL_1564 | |
| SW948 cells | Colon | Homo sapiens (Human) | CVCL_0632 | |
| HT55 cells | Colon | Homo sapiens (Human) | CVCL_1294 | |
| SW403 cells | Colon | Homo sapiens (Human) | CVCL_0545 | |
| 293FT cells | Kidney | Homo sapiens (Human) | CVCL_6911 | |
| T84 cells | Colon | Homo sapiens (Human) | CVCL_0555 | |
| HCEC cells | N.A. | N.A. | N.A. | |
| In Vivo Model | Female athymic nude mouse PDX model | Mus musculus | ||
| Experiment for Drug Resistance |
Promega assay | |||
| Mechanism Description | TASIN-1 exerts its cytotoxic effects through inhibition of cholesterol biosynthesis. | |||
| Key Molecule: Adenomatous polyposis coli protein (APC) | [1] | |||
| Sensitive Disease | Colorectal cancer [ICD-11: 2B91.1] | |||
| Molecule Alteration | Nonsense | p.E1309* (c.3925G>T) |
||
| Experimental Note | Revealed Based on the Cell Line Data | |||
| In Vitro Model | HT29 Cells | Colon | Homo sapiens (Human) | CVCL_A8EZ |
| SW480 cells | Colon | Homo sapiens (Human) | CVCL_0546 | |
| DLD1 cells | Colon | Homo sapiens (Human) | CVCL_0248 | |
| SW620 cells | Colon | Homo sapiens (Human) | CVCL_0547 | |
| HCT116 cells | Colon | Homo sapiens (Human) | CVCL_0291 | |
| RkO cells | Colon | Homo sapiens (Human) | CVCL_0504 | |
| NCI-H508 cells | Colon | Homo sapiens (Human) | CVCL_1564 | |
| SW948 cells | Colon | Homo sapiens (Human) | CVCL_0632 | |
| HT55 cells | Colon | Homo sapiens (Human) | CVCL_1294 | |
| SW403 cells | Colon | Homo sapiens (Human) | CVCL_0545 | |
| 293FT cells | Kidney | Homo sapiens (Human) | CVCL_6911 | |
| T84 cells | Colon | Homo sapiens (Human) | CVCL_0555 | |
| HCEC cells | N.A. | N.A. | N.A. | |
| In Vivo Model | Female athymic nude mouse PDX model | Mus musculus | ||
| Experiment for Drug Resistance |
Promega assay | |||
| Mechanism Description | TASIN-1 exerts its cytotoxic effects through inhibition of cholesterol biosynthesis. | |||
| Key Molecule: Adenomatous polyposis coli protein (APC) | [1] | |||
| Sensitive Disease | Colorectal cancer [ICD-11: 2B91.1] | |||
| Molecule Alteration | Nonsense | p.Q1338* (c.4012C>T) |
||
| Experimental Note | Revealed Based on the Cell Line Data | |||
| In Vitro Model | HT29 Cells | Colon | Homo sapiens (Human) | CVCL_A8EZ |
| SW480 cells | Colon | Homo sapiens (Human) | CVCL_0546 | |
| DLD1 cells | Colon | Homo sapiens (Human) | CVCL_0248 | |
| SW620 cells | Colon | Homo sapiens (Human) | CVCL_0547 | |
| HCT116 cells | Colon | Homo sapiens (Human) | CVCL_0291 | |
| RkO cells | Colon | Homo sapiens (Human) | CVCL_0504 | |
| NCI-H508 cells | Colon | Homo sapiens (Human) | CVCL_1564 | |
| SW948 cells | Colon | Homo sapiens (Human) | CVCL_0632 | |
| HT55 cells | Colon | Homo sapiens (Human) | CVCL_1294 | |
| SW403 cells | Colon | Homo sapiens (Human) | CVCL_0545 | |
| 293FT cells | Kidney | Homo sapiens (Human) | CVCL_6911 | |
| T84 cells | Colon | Homo sapiens (Human) | CVCL_0555 | |
| HCEC cells | N.A. | N.A. | N.A. | |
| In Vivo Model | Female athymic nude mouse PDX model | Mus musculus | ||
| Experiment for Drug Resistance |
Promega assay | |||
| Mechanism Description | TASIN-1 exerts its cytotoxic effects through inhibition of cholesterol biosynthesis. | |||
References
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Yu.
