Drug Information
Drug (ID: DG01607) and It's Reported Resistant Information
| Name |
LY-3023414
|
||||
|---|---|---|---|---|---|
| Synonyms |
LY3023414; Samotolisib; 1386874-06-1; LY-3023414; GTPL8918; UNII-C88817F47Y; Samotolisib (USAN); Samotolisib [USAN]; C88817F47Y; LY 3023414; 8-[5-(2-hydroxypropan-2-yl)pyridin-3-yl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one; 2H-Imidazo(4,5-C)quinolin-2-one, 1,3-dihydro-8-(5-(1-hydroxy-1-methylethyl)-3-pyridinyl)-1-((2S)-2-methoxypropyl)-3-methyl-; 8-[5-(1-hydroxy-1-methylethyl)pyridin-3-yl]-1-[(2S)-2-methoxypropyl]-3-methyl-1,3-dihydro-2H-imidazo[4,5-c]quinolin-2-one; example 1 [US8440829]; 2H-Imidazo[4,5-c]quinolin-2-one, 1,3-dihydro-8-[5-(1-hydroxy-1-methylethyl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methyl-; CHEMBL4297181; SCHEMBL10321700; BCP16703; EX-A2728; NSC789968; NSC800994; s8322; WHO 10889; ZINC143116580; AT19320; CCG-264765; CS-5361; DB12167; NSC-789968; NSC-800994; NCGC00485487-01; AC-30224; HY-12513; A16126; D11501; A856859; LY-3023414;LY 3023414; Q27082852; (S)-8-(5-(2-hydroxypropan-2-yl)pyridin-3-yl)-1-(2-methoxypropyl)-3-methyl-1,3-dihydro-2H-imidazo[4,5-c]quinolin-2-one; (S)-8-(5-(2-hydroxypropan-2-yl)pyridin-3-yl)-1-(2-methoxypropyl)-3-methyl-1H-imidazo[4,5-c]quinolin-2(3H)-one; 1,3-Dihydro-8-[5-(1-hydroxy-1-methylethyl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methyl-2H-imidazo[4,5-c]quinolin-2-one
Click to Show/Hide
|
||||
| Indication |
In total 1 Indication(s)
|
||||
| Structure |
|
||||
| Target | V-erbA-related protein 1 (NR1D1) | NR1D1_HUMAN | [1] | ||
| Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
| Formula |
5
|
||||
| IsoSMILES |
C[C@@H](CN1C2=C3C=C(C=CC3=NC=C2N(C1=O)C)C4=CC(=CN=C4)C(C)(C)O)OC
|
||||
| InChI |
InChI=1S/C23H26N4O3/c1-14(30-5)13-27-21-18-9-15(16-8-17(11-24-10-16)23(2,3)29)6-7-19(18)25-12-20(21)26(4)22(27)28/h6-12,14,29H,13H2,1-5H3/t14-/m0/s1
|
||||
| InChIKey |
ACCFLVVUVBJNGT-AWEZNQCLSA-N
|
||||
| PubChem CID | |||||
| TTD Drug ID | |||||
| DrugBank ID | |||||
Type(s) of Resistant Mechanism of This Drug
UAPP: Unusual Activation of Pro-survival Pathway
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
Acute lymphocytic leukemia [ICD-11: 2B33]
| Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
Unusual Activation of Pro-survival Pathway (UAPP)
|
||||
| Key Molecule: PI3-kinase alpha (PIK3CA) | [1] | |||
| Molecule Alteration | Missense mutation | p.E545K (c.1633G>A) |
||
| Sensitive Disease | Acute lymphocytic leukemia [ICD-11: 2B33.0] | |||
| Experimental Note | Revealed Based on the Cell Line Data | |||
| Cell Pathway Regulation | PI3K signaling pathway | Inhibition | hsa04151 | |
| In Vitro Model | A2780 cells | Ovary | Homo sapiens (Human) | CVCL_0134 |
| THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
| NCI-H446 cells | Lung | Homo sapiens (Human) | CVCL_1562 | |
| AsPC-1 cells | Pancreas | Homo sapiens (Human) | CVCL_0152 | |
| SJSA-1 cells | Bone | Homo sapiens (Human) | CVCL_1697 | |
| NCI-H1650 cells | Lung | Homo sapiens (Human) | CVCL_1483 | |
| MSTO-211H cells | Lung | Homo sapiens (Human) | CVCL_1430 | |
| 786-O cells | Kidney | Homo sapiens (Human) | CVCL_1051 | |
| NCI-H1975 cells | Lung | Homo sapiens (Human) | CVCL_1511 | |
| NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
| NCI-H1734 cells | Lung | Homo sapiens (Human) | CVCL_1491 | |
| NCI-H1395 cells | Lung | Homo sapiens (Human) | CVCL_1467 | |
| NCI-H226 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1544 | |
| NCI-H1993 cells | Lymph node | Homo sapiens (Human) | CVCL_1512 | |
| NCI-H1703 cells | Lung | Homo sapiens (Human) | CVCL_1490 | |
| NCI-H1299 cells | Lymph node | Homo sapiens (Human) | CVCL_0060 | |
| NCI- H460 cells | Pleural effusion | Homo sapiens (Human) | CVCL_0459 | |
| ACC-MESO-4 cells | Pleural epithelium | Homo sapiens (Human) | CVCL_5114 | |
| ACC-MESO-1 cells | Pleural epithelium | Homo sapiens (Human) | CVCL_5113 | |
| Experiment for Drug Resistance |
CellTitre-Glo assay; Caspase-Glo 3/7 assay | |||
Lung cancer [ICD-11: 2C25]
| Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
|
Unusual Activation of Pro-survival Pathway (UAPP)
|
||||
| Key Molecule: PI3-kinase alpha (PIK3CA) | [1] | |||
| Molecule Alteration | Missense mutation | p.G118D (c.353G>A) |
||
| Sensitive Disease | Lung adenocarcinoma [ICD-11: 2C25.0] | |||
| Experimental Note | Revealed Based on the Cell Line Data | |||
| Cell Pathway Regulation | PI3K signaling pathway | Inhibition | hsa04151 | |
| In Vitro Model | A2780 cells | Ovary | Homo sapiens (Human) | CVCL_0134 |
| THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
| NCI-H446 cells | Lung | Homo sapiens (Human) | CVCL_1562 | |
| AsPC-1 cells | Pancreas | Homo sapiens (Human) | CVCL_0152 | |
| SJSA-1 cells | Bone | Homo sapiens (Human) | CVCL_1697 | |
| NCI-H1650 cells | Lung | Homo sapiens (Human) | CVCL_1483 | |
| MSTO-211H cells | Lung | Homo sapiens (Human) | CVCL_1430 | |
| 786-O cells | Kidney | Homo sapiens (Human) | CVCL_1051 | |
| NCI-H1975 cells | Lung | Homo sapiens (Human) | CVCL_1511 | |
| NCI-H520 cells | Lung | Homo sapiens (Human) | CVCL_1566 | |
| NCI-H1734 cells | Lung | Homo sapiens (Human) | CVCL_1491 | |
| NCI-H1395 cells | Lung | Homo sapiens (Human) | CVCL_1467 | |
| NCI-H226 cells | Pleural effusion | Homo sapiens (Human) | CVCL_1544 | |
| NCI-H1993 cells | Lymph node | Homo sapiens (Human) | CVCL_1512 | |
| NCI-H1703 cells | Lung | Homo sapiens (Human) | CVCL_1490 | |
| NCI-H1299 cells | Lymph node | Homo sapiens (Human) | CVCL_0060 | |
| NCI- H460 cells | Pleural effusion | Homo sapiens (Human) | CVCL_0459 | |
| ACC-MESO-4 cells | Pleural epithelium | Homo sapiens (Human) | CVCL_5114 | |
| ACC-MESO-1 cells | Pleural epithelium | Homo sapiens (Human) | CVCL_5113 | |
| Experiment for Drug Resistance |
CellTiter-Glo assay; Caspase-Glo 3/7 assay | |||
References
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Zhang.