Drug Information
Drug (ID: DG01599) and It's Reported Resistant Information
Name |
Altiratinib
|
||||
---|---|---|---|---|---|
Synonyms |
Altiratinib; 1345847-93-9; DCC-2701; DP-5164; Altiratinib [USAN]; UNII-T678746713; Altiratinib (USAN); 1,1-Cyclopropanedicarboxamide, N-[4-[[2-[(cyclopropylcarbonyl)amino]-4-pyridinyl]oxy]-2,5-difluorophenyl]-N'-(4-fluorophenyl)-; T678746713; 1,1-Cyclopropanedicarboxamide, N-(4-((2-((cyclopropylcarbonyl)amino)-4-pyridinyl)oxy)-2,5-difluorophenyl)-N'-(4-fluorophenyl)-; 1-N'-[4-[2-(cyclopropanecarbonylamino)pyridin-4-yl]oxy-2,5-difluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide; N-(4-((2-(cyclopropanecarboxamido)pyridin-4-yl)oxy)-2,5-difluorophenyl)-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.; N-[4-[[2-[(Cyclopropylcarbonyl)amino]-4-pyridinyl]oxy]-2,5-difluorophenyl]-N'-(4-fluorophenyl)-1,1-cyclopropanedicarboxamide; Altiratinib;DCC2701; Altiratinib(DCC-2701); SCHEMBL139906; GTPL9174; CHEMBL3545365; DCC-270; DCC2701; EX-A902; AOB87118; BCP15682; HY-B0791; BDBM50193395; MFCD28900672; NSC784590; s6412; AKOS026750329; ZINC113198271; CS-3944; NSC-784590; SB18876; NCGC00480913-04; N-(4-((2-((Cyclopropylcarbonyl)amino)pyridin-4-yl)oxy)-2,5-difluorophenyi)-N-(4- fluorophenyl)cyclopropane-1,1-dicarboxamide; B5832; FT-0700171; A14387; D10862; F11464; A887875; J-690136; Q27074416; 1,1-CYCLOPROPANEDICARBOXAMIDE, N-[4-[[2-[(CYCLOPROPYLCARBONYL)AMINO]-4-PYRIDINYL]OXY]-2,5-DIFLUOROPHENYL]-N-(4-FLUOROPHENYL)-; 4-{5-[(E)-2-{4-(2-Chlorophenyl)-5-[5-(methylsulfonyl)-2-pyridinyl]-4H-1,2,4-triazol-3-yl}vinyl]-1,3,4-oxadiazol-2-yl}benzonitrile; N-(4-(2-(cyclopropanecarboxamido)pyridin-4-yloxy)-2,5-difluorophenyl)-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide
Click to Show/Hide
|
||||
Indication |
In total 2 Indication(s)
|
||||
Structure | |||||
Target | Vascular endothelial growth factor receptor 2 (KDR) | VGFR2_HUMAN | [1] | ||
Click to Show/Hide the Molecular Information and External Link(s) of This Drug | |||||
Formula |
8
|
||||
IsoSMILES |
C1CC1C(=O)NC2=NC=CC(=C2)OC3=C(C=C(C(=C3)F)NC(=O)C4(CC4)C(=O)NC5=CC=C(C=C5)F)F
|
||||
InChI |
InChI=1S/C26H21F3N4O4/c27-15-3-5-16(6-4-15)31-24(35)26(8-9-26)25(36)32-20-12-19(29)21(13-18(20)28)37-17-7-10-30-22(11-17)33-23(34)14-1-2-14/h3-7,10-14H,1-2,8-9H2,(H,31,35)(H,32,36)(H,30,33,34)
|
||||
InChIKey |
GNNDEPIMDAZHRQ-UHFFFAOYSA-N
|
||||
PubChem CID |
Type(s) of Resistant Mechanism of This Drug
RTDM: Regulation by the Disease Microenvironment
Drug Resistance Data Categorized by Their Corresponding Diseases
ICD-02: Benign/in-situ/malignant neoplasm
Solid tumour/cancer [ICD-11: 2A00-2F9Z]
Drug Sensitivity Data Categorized by Their Corresponding Mechanisms | ||||
Regulation by the Disease Microenvironment (RTDM) | ||||
Key Molecule: Hepatocyte growth factor receptor (MET) | [1] | |||
Molecule Alteration | Missense mutation | p.D1228N (c.3682G>A) |
||
Sensitive Disease | Solid tumour/cancer [ICD-11: 2A00-2F9Z] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | A549 cells | Lung | Homo sapiens (Human) | CVCL_0023 |
A375 cells | Skin | Homo sapiens (Human) | CVCL_0132 | |
THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
K562 cells | Blood | Homo sapiens (Human) | CVCL_0004 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
Sk-N-SH cells | Adrenal | Homo sapiens (Human) | CVCL_0531 | |
HCT-116 cells | Colon | Homo sapiens (Human) | N.A. | |
EBC-1 cells | Lung | Homo sapiens (Human) | CVCL_2891 | |
MRC-5 cells | Lung | Homo sapiens (Human) | CVCL_0440 | |
PC-3 cells | Prostate | Homo sapiens (Human) | CVCL_0035 | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
U87-MG cells | Brain | Homo sapiens (Human) | CVCL_0022 | |
SkMEL5 cells | Skin | Homo sapiens (Human) | CVCL_0527 | |
SkMEL28 cells | Skin | Homo sapiens (Human) | CVCL_0526 | |
MV-4-11 cells | Peripheral blood | Homo sapiens (Human) | CVCL_0064 | |
M-NFS-60 cells | Blood | Mus musculus (Mouse) | CVCL_3543 | |
KM-12 cells | Colon | Homo sapiens (Human) | CVCL_1331 | |
HMVEC cells | Blood vessel | Homo sapiens (Human) | N.A. | |
EAhy926 cells | N.A. | Homo sapiens (Human) | CVCL_3901 | |
CHO-K cells | Ovary | Cricetulus griseus (Chinese hamster) (Cricetulus barabensis griseus) | CVCL_0213 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
B16/F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Mouse xenograft efficacy model; MKN-45 xenograft mouse pharmacokinetic/pharmacodynamic model; Orthotopic U87-MG xenograft efficacy model; Orthotopic U87-MG xenograft survival model; PyMT syngeneic breast cancer model | Mus musculus | ||
Experiment for Molecule Alteration |
Enzyme-linked immunosorbent assay; Western blotting analysis | |||
Experiment for Drug Resistance |
Resazurin cell viability assay | |||
Key Molecule: Hepatocyte growth factor receptor (MET) | [1] | |||
Molecule Alteration | Missense mutation | p.Y1230H (c.3688T>C) |
||
Sensitive Disease | Solid tumour/cancer [ICD-11: 2A00-2F9Z] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | A549 cells | Lung | Homo sapiens (Human) | CVCL_0023 |
A375 cells | Skin | Homo sapiens (Human) | CVCL_0132 | |
THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
K562 cells | Blood | Homo sapiens (Human) | CVCL_0004 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
Sk-N-SH cells | Adrenal | Homo sapiens (Human) | CVCL_0531 | |
HCT-116 cells | Colon | Homo sapiens (Human) | N.A. | |
EBC-1 cells | Lung | Homo sapiens (Human) | CVCL_2891 | |
MRC-5 cells | Lung | Homo sapiens (Human) | CVCL_0440 | |
PC-3 cells | Prostate | Homo sapiens (Human) | CVCL_0035 | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
U87-MG cells | Brain | Homo sapiens (Human) | CVCL_0022 | |
SkMEL5 cells | Skin | Homo sapiens (Human) | CVCL_0527 | |
SkMEL28 cells | Skin | Homo sapiens (Human) | CVCL_0526 | |
MV-4-11 cells | Peripheral blood | Homo sapiens (Human) | CVCL_0064 | |
M-NFS-60 cells | Blood | Mus musculus (Mouse) | CVCL_3543 | |
KM-12 cells | Colon | Homo sapiens (Human) | CVCL_1331 | |
HMVEC cells | Blood vessel | Homo sapiens (Human) | N.A. | |
EAhy926 cells | N.A. | Homo sapiens (Human) | CVCL_3901 | |
CHO-K cells | Ovary | Cricetulus griseus (Chinese hamster) (Cricetulus barabensis griseus) | CVCL_0213 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
B16/F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Mouse xenograft efficacy model; MKN-45 xenograft mouse pharmacokinetic/pharmacodynamic model; Orthotopic U87-MG xenograft efficacy model; Orthotopic U87-MG xenograft survival model; PyMT syngeneic breast cancer model | Mus musculus | ||
Experiment for Molecule Alteration |
Enzyme-linked immunosorbent assay; Western blotting analysis | |||
Experiment for Drug Resistance |
Resazurin cell viability assay | |||
Key Molecule: Hepatocyte growth factor receptor (MET) | [1] | |||
Molecule Alteration | Missense mutation | p.Y1230D (c.3688T>G) |
||
Sensitive Disease | Solid tumour/cancer [ICD-11: 2A00-2F9Z] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | A549 cells | Lung | Homo sapiens (Human) | CVCL_0023 |
A375 cells | Skin | Homo sapiens (Human) | CVCL_0132 | |
THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
K562 cells | Blood | Homo sapiens (Human) | CVCL_0004 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
Sk-N-SH cells | Adrenal | Homo sapiens (Human) | CVCL_0531 | |
HCT-116 cells | Colon | Homo sapiens (Human) | N.A. | |
EBC-1 cells | Lung | Homo sapiens (Human) | CVCL_2891 | |
MRC-5 cells | Lung | Homo sapiens (Human) | CVCL_0440 | |
PC-3 cells | Prostate | Homo sapiens (Human) | CVCL_0035 | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
U87-MG cells | Brain | Homo sapiens (Human) | CVCL_0022 | |
SkMEL5 cells | Skin | Homo sapiens (Human) | CVCL_0527 | |
SkMEL28 cells | Skin | Homo sapiens (Human) | CVCL_0526 | |
MV-4-11 cells | Peripheral blood | Homo sapiens (Human) | CVCL_0064 | |
M-NFS-60 cells | Blood | Mus musculus (Mouse) | CVCL_3543 | |
KM-12 cells | Colon | Homo sapiens (Human) | CVCL_1331 | |
HMVEC cells | Blood vessel | Homo sapiens (Human) | N.A. | |
EAhy926 cells | N.A. | Homo sapiens (Human) | CVCL_3901 | |
CHO-K cells | Ovary | Cricetulus griseus (Chinese hamster) (Cricetulus barabensis griseus) | CVCL_0213 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
B16/F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Mouse xenograft efficacy model; MKN-45 xenograft mouse pharmacokinetic/pharmacodynamic model; Orthotopic U87-MG xenograft efficacy model; Orthotopic U87-MG xenograft survival model; PyMT syngeneic breast cancer model | Mus musculus | ||
Experiment for Molecule Alteration |
Enzyme-linked immunosorbent assay; Western blotting analysis | |||
Experiment for Drug Resistance |
Resazurin cell viability assay | |||
Key Molecule: Hepatocyte growth factor receptor (MET) | [1] | |||
Molecule Alteration | Missense mutation | p.Y1230C (c.3689A>G) |
||
Sensitive Disease | Solid tumour/cancer [ICD-11: 2A00-2F9Z] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | A549 cells | Lung | Homo sapiens (Human) | CVCL_0023 |
A375 cells | Skin | Homo sapiens (Human) | CVCL_0132 | |
THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
K562 cells | Blood | Homo sapiens (Human) | CVCL_0004 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
Sk-N-SH cells | Adrenal | Homo sapiens (Human) | CVCL_0531 | |
HCT-116 cells | Colon | Homo sapiens (Human) | N.A. | |
EBC-1 cells | Lung | Homo sapiens (Human) | CVCL_2891 | |
MRC-5 cells | Lung | Homo sapiens (Human) | CVCL_0440 | |
PC-3 cells | Prostate | Homo sapiens (Human) | CVCL_0035 | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
U87-MG cells | Brain | Homo sapiens (Human) | CVCL_0022 | |
SkMEL5 cells | Skin | Homo sapiens (Human) | CVCL_0527 | |
SkMEL28 cells | Skin | Homo sapiens (Human) | CVCL_0526 | |
MV-4-11 cells | Peripheral blood | Homo sapiens (Human) | CVCL_0064 | |
M-NFS-60 cells | Blood | Mus musculus (Mouse) | CVCL_3543 | |
KM-12 cells | Colon | Homo sapiens (Human) | CVCL_1331 | |
HMVEC cells | Blood vessel | Homo sapiens (Human) | N.A. | |
EAhy926 cells | N.A. | Homo sapiens (Human) | CVCL_3901 | |
CHO-K cells | Ovary | Cricetulus griseus (Chinese hamster) (Cricetulus barabensis griseus) | CVCL_0213 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
B16/F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Mouse xenograft efficacy model; MKN-45 xenograft mouse pharmacokinetic/pharmacodynamic model; Orthotopic U87-MG xenograft efficacy model; Orthotopic U87-MG xenograft survival model; PyMT syngeneic breast cancer model | Mus musculus | ||
Experiment for Molecule Alteration |
Enzyme-linked immunosorbent assay; Western blotting analysis | |||
Experiment for Drug Resistance |
Resazurin cell viability assay | |||
Key Molecule: Hepatocyte growth factor receptor (MET) | [1] | |||
Molecule Alteration | Missense mutation | p.M1250T (c.3749T>C) |
||
Sensitive Disease | Solid tumour/cancer [ICD-11: 2A00-2F9Z] | |||
Experimental Note | Revealed Based on the Cell Line Data | |||
In Vitro Model | A549 cells | Lung | Homo sapiens (Human) | CVCL_0023 |
A375 cells | Skin | Homo sapiens (Human) | CVCL_0132 | |
THP-1 cells | Blood | Homo sapiens (Human) | CVCL_0006 | |
K562 cells | Blood | Homo sapiens (Human) | CVCL_0004 | |
MkN-45 cells | Gastric | Homo sapiens (Human) | CVCL_0434 | |
Sk-N-SH cells | Adrenal | Homo sapiens (Human) | CVCL_0531 | |
HCT-116 cells | Colon | Homo sapiens (Human) | N.A. | |
EBC-1 cells | Lung | Homo sapiens (Human) | CVCL_2891 | |
MRC-5 cells | Lung | Homo sapiens (Human) | CVCL_0440 | |
PC-3 cells | Prostate | Homo sapiens (Human) | CVCL_0035 | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
HUVEC cells | Endothelium | Homo sapiens (Human) | N.A. | |
U87-MG cells | Brain | Homo sapiens (Human) | CVCL_0022 | |
SkMEL5 cells | Skin | Homo sapiens (Human) | CVCL_0527 | |
SkMEL28 cells | Skin | Homo sapiens (Human) | CVCL_0526 | |
MV-4-11 cells | Peripheral blood | Homo sapiens (Human) | CVCL_0064 | |
M-NFS-60 cells | Blood | Mus musculus (Mouse) | CVCL_3543 | |
KM-12 cells | Colon | Homo sapiens (Human) | CVCL_1331 | |
HMVEC cells | Blood vessel | Homo sapiens (Human) | N.A. | |
EAhy926 cells | N.A. | Homo sapiens (Human) | CVCL_3901 | |
CHO-K cells | Ovary | Cricetulus griseus (Chinese hamster) (Cricetulus barabensis griseus) | CVCL_0213 | |
BT-474 cells | Breast | Homo sapiens (Human) | CVCL_0179 | |
B16/F10 cells | Skin | Mus musculus (Mouse) | CVCL_0159 | |
In Vivo Model | Mouse xenograft efficacy model; MKN-45 xenograft mouse pharmacokinetic/pharmacodynamic model; Orthotopic U87-MG xenograft efficacy model; Orthotopic U87-MG xenograft survival model; PyMT syngeneic breast cancer model | Mus musculus | ||
Experiment for Molecule Alteration |
Enzyme-linked immunosorbent assay; Western blotting analysis | |||
Experiment for Drug Resistance |
Resazurin cell viability assay |
References
If you find any error in data or bug in web service, please kindly report it to Dr. Sun and Dr. Zhang.